Заглавная страница Избранные статьи Случайная статья Познавательные статьи Новые добавления Обратная связь FAQ Написать работу КАТЕГОРИИ: ТОП 10 на сайте Приготовление дезинфицирующих растворов различной концентрацииТехника нижней прямой подачи мяча. Франко-прусская война (причины и последствия) Организация работы процедурного кабинета Смысловое и механическое запоминание, их место и роль в усвоении знаний Коммуникативные барьеры и пути их преодоления Обработка изделий медицинского назначения многократного применения Образцы текста публицистического стиля Четыре типа изменения баланса Задачи с ответами для Всероссийской олимпиады по праву
Мы поможем в написании ваших работ! ЗНАЕТЕ ЛИ ВЫ?
Влияние общества на человека
Приготовление дезинфицирующих растворов различной концентрации Практические работы по географии для 6 класса Организация работы процедурного кабинета Изменения в неживой природе осенью Уборка процедурного кабинета Сольфеджио. Все правила по сольфеджио Балочные системы. Определение реакций опор и моментов защемления |
Questions and tasks for self solutionСодержание книги
Поиск на нашем сайте
1. What reactions can be called: a) irreversible; b) reversible; c)direct; d) reverse? Give the examples. 2. What difference exists between rate constants for direct and reverse reactions 3. How do the rates of direct and reverse reactions change? Why? 4. What is the chemical equilibrium? Why it is the dynamic? What concentrations of reactant are named as equilibrium? 5. What is called the constant of equilibrium? Does this value depend on nature of reactants, their concentrations, temperature, pressure? 6. Why does the numeral value of equilibrium constant define the extent of conversion of initial reagents into products. 7. Why does the expression of equilibrium constant not include the solid concentrations? 8. What parameters is the chemical equilibrium characterized by? List them. 9. What process is called as the shift of equilibrium? 10. Show, using examples, how does the equilibrium shift if there is the change of a) concentration of some reactant, b)temperature, c) pressure. 11. Rate of which reaction increases in greater extent (exo- or endothermic) if the equilibrium system is heated? 12. Does the catalyst influence on the state of equilibrium, why? Does the equilibrium constant depend on catalyst? 13. Which activation energy is more – of direct or reverse reaction, if direct reaction proceeds with heat evolving? 14. What reaction is exothermic if at given temperature rate constant of direct reaction is more then this one of reverse reaction? 15. Write down the expression for Kc for the following reactions: a) 2NO(g) + O2(g)↔2NO2(g) b) CH3COOH(solution)↔CH3COO-(solution)+H+(sol) c) MgCO3(solid) ↔ MgO(solid) + CO2(g) d) [HgI4]2-(solution)↔Hg2+(solution) + 4I-(solution) e) H2O(liq) ↔ H+(solution) + OH-(solution) f) 3Fe(solid) + 4H2O(liq)↔Fe3O4(solid) + 4H2(g) 16. Equilibrium constant at 4500C for reaction H2 + I2 ↔2HI is equal to 50,0. Find the equilibrium constant for reaction of HI dissociation at the same temperature. The answer: 0,02 17. Find the equilibrium constant for homogeneous reaction A + B ↔ C + D, if initial A and B concentrations are equal to 0,8 mol/l for each one and equilibrium concentrations of C and D are equal to 0,6 mol/l. The answer: 9. 18. What is the equilibrium constant Kp for reaction: 2HI(g)↔H2(g)+I2(g) at 4480C, if partial equilibrium pressures of gases at given temperature are: p(HI) = 40,5 kPa, p(H2) = 75,2 kPa, p(I2) = 0,436 kPa? The answer: 0,02. 19. The equilibrium for system: PCl5(g)↔PCl3(g) + Cl2(g) at 5000K have been established, when initial PCl5 concentration, equal 1 mol/l decreased till 0,46 mol/l Find Kc at given temperature. The answer:0,634 20. Solve for equilibrium constant: 4HCl(g) + O2(g)↔2Cl2(g) + 2H2O(g) if initial amounts of substances were 2,4 moles of HCl and 1,2 moles of O2 but to the moment of equilibrium 0,8 moles of HCl have been remained as nonreacted. The volume of reaction vessel is equal to 4L. The answer: 5. 21. Solve for equilibrium constant of the reaction: N2(g) + 3H2(g)↔ 2NH3(g), if 0,05 moles of N2 and 0,52 moles of H2 were introduced into reaction vessel which volume is 10 L, at some temperature and to the equilibrium moment 0,04moles of ammonia were formed. The answer: 54,8. 22. At 6500C the equilibrium constant of the system CO2(g) + H2(g) ↔ CO(g) + H2O(g) is equal to 1. The initial concentrations of CO2 and H2 were 0,2 and 0,8 mol/l. Solve for equilibrium concentrations of all reactants. The answer: 0,04; 0,64; 0,16; 0,16 mol/l. 23. The equilibrium constant for reaction FeO(solid) + CO(g) ↔ Fe(solid) + CO2(g) at 10000C is equal to 0,5. The initial concentrations of CO and CO2 were 0,05 and 0,01 mol/l. Find their equilibrium concentrations. The answer: 0,04 and 0,02 mol/l. 24. Find equilibrium constant of the reaction N2O4↔2NO2, if initial concentration of N2O4 was 0,08 mol/l and to the equilibrium moment 50% of N2O4 have dissociated. The answer: 0,16. 25. Will the introducing of additional amounts of a) CO2, b) CaCO3 influence on the equilibrium concentration of CO2 in the system: CaCO3(solid) ↔ CaO(solid) + CO2(g)? 26 What conditions will facilitate to the more producing of SO3 according to the reaction SO2 + 1/2O2↔SO3; ∆H0298 = -98,9 kJ/mol? What mass of SO2 is consumed if SO3 with mass 10g is formed. The answer: 8g. 27 In what side does the equilibrium shift: a) 2H2S(g)↔2H2(g) + S2(solid); ∆H = 40,13 kJ b) N2O4(liq)↔2NO2(g); ∆H = 66,55 kJ с) CO(g) + H2O(g) ↔CO2(g) + H2(g); ∆ H = -40,96 kJ if 1) the temperature increases 2) the pressure increases? 28 In what side will the equilibrium shift if the temperature increases in the system: a) N2(g) + 3H2(g)↔2NH3(g), ∆H = -92,4 kJ b) 2CO2(g)↔2CO(g) + O2(g), ∆H = 556kJ c) 4HCl(g) + O2(g)↔ 2Cl2(g) + 2H2O(liq) , ∆H = -202,4kJ 29. How can we change the concentrations of reactants to shift the equilibrium to right: CO2(g) + C(coul)↔2CO(g) 30. In what direction does the equilibrium shift A2(g) + B2(g)↔2AB(g), if to increase the pressure 2 times higher and simultaneously to increase the temperature by 100? Temperature coefficients of the rates of direct and reverse reactions are equal correspondingly 2 and 3. What sign of ∆H0 is here? The answer: to left, ∆H0 < 0.
Example of the test card on the topic:
|
||
|
Последнее изменение этой страницы: 2020-12-17; просмотров: 192; Нарушение авторского права страницы; Мы поможем в написании вашей работы! infopedia.su Все материалы представленные на сайте исключительно с целью ознакомления читателями и не преследуют коммерческих целей или нарушение авторских прав. Обратная связь - 216.73.217.110 (0.008 с.) |